C16H18F2N2O4S2 — CID 60500507
N-[2-[4-(difluoromethylsulfonyl)anilino]ethyl]-4-methylbenzenesulfonamide (PubChem CID 60500507) has the molecular formula C16H18F2N2O4S2 and a molecular weight of 404.46 g/mol. Its IUPAC name is N-[2-[4-(difluoromethylsulfonyl)anilino]ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-[4-(difluoromethylsulfonyl)anilino]ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 60500507 |
| Molecular Formula | C16H18F2N2O4S2 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | N-[2-[4-(difluoromethylsulfonyl)anilino]ethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNc2ccc(S(=O)(=O)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H18F2N2O4S2/c1-12-2-6-15(7-3-12)26(23,24)20-11-10-19-13-4-8-14(9-5-13)25(21,22)16(17)18/h2-9,16,19-20H,10-11H2,1H3 |
| InChIKey | MPKNEWDFCMLHRE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|