C13H19F2NO2S — CID 60966150
4-(difluoromethylsulfonyl)-N-(3,3-dimethylbutyl)aniline (PubChem CID 60966150) has the molecular formula C13H19F2NO2S and a molecular weight of 291.36 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-(3,3-dimethylbutyl)aniline.
| Compound Name | 4-(difluoromethylsulfonyl)-N-(3,3-dimethylbutyl)aniline |
|---|---|
| PubChem CID | 60966150 |
| Molecular Formula | C13H19F2NO2S |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-(3,3-dimethylbutyl)aniline |
| SMILES | CC(C)(C)CCNc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C13H19F2NO2S/c1-13(2,3)8-9-16-10-4-6-11(7-5-10)19(17,18)12(14)15/h4-7,12,16H,8-9H2,1-3H3 |
| InChIKey | ITGFGNVOPUQGMA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |