C11H13F2NO4S — CID 61262117
2-[4-(difluoromethylsulfonyl)anilino]-2-methylpropanoic acid (PubChem CID 61262117) has the molecular formula C11H13F2NO4S and a molecular weight of 293.29 g/mol. Its IUPAC name is 2-[4-(difluoromethylsulfonyl)anilino]-2-methylpropanoic acid.
| Compound Name | 2-[4-(difluoromethylsulfonyl)anilino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 61262117 |
| Molecular Formula | C11H13F2NO4S |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 2-[4-(difluoromethylsulfonyl)anilino]-2-methylpropanoic acid |
| SMILES | CC(C)(Nc1ccc(S(=O)(=O)C(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C11H13F2NO4S/c1-11(2,9(15)16)14-7-3-5-8(6-4-7)19(17,18)10(12)13/h3-6,10,14H,1-2H3,(H,15,16) |
| InChIKey | RNZNMKDSLJRUHI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |