C14H21F2NO3S — CID 66178235
1-[4-(difluoromethylsulfonyl)anilino]-2,4-dimethylpentan-2-ol (PubChem CID 66178235) has the molecular formula C14H21F2NO3S and a molecular weight of 321.39 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfonyl)anilino]-2,4-dimethylpentan-2-ol.
| Compound Name | 1-[4-(difluoromethylsulfonyl)anilino]-2,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 66178235 |
| Molecular Formula | C14H21F2NO3S |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 1-[4-(difluoromethylsulfonyl)anilino]-2,4-dimethylpentan-2-ol |
| SMILES | CC(C)CC(C)(O)CNc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C14H21F2NO3S/c1-10(2)8-14(3,18)9-17-11-4-6-12(7-5-11)21(19,20)13(15)16/h4-7,10,13,17-18H,8-9H2,1-3H3 |
| InChIKey | YSBKZJBCDYVYAP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |