C9H8F5NO2S — CID 43383566
4-(difluoromethylsulfonyl)-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 43383566) has the molecular formula C9H8F5NO2S and a molecular weight of 289.23 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 4-(difluoromethylsulfonyl)-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 43383566 |
| Molecular Formula | C9H8F5NO2S |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | O=S(=O)(c1ccc(NCC(F)(F)F)cc1)C(F)F |
| InChI | InChI=1S/C9H8F5NO2S/c10-8(11)18(16,17)7-3-1-6(2-4-7)15-5-9(12,13)14/h1-4,8,15H,5H2 |
| InChIKey | NJDYJYXVAXFQEN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |