C9H11F3N2O2S — CID 43453835
N-methyl-4-(2,2,2-trifluoroethylamino)benzenesulfonamide (PubChem CID 43453835) has the molecular formula C9H11F3N2O2S and a molecular weight of 268.26 g/mol. Its IUPAC name is N-methyl-4-(2,2,2-trifluoroethylamino)benzenesulfonamide.
| Compound Name | N-methyl-4-(2,2,2-trifluoroethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 43453835 |
| Molecular Formula | C9H11F3N2O2S |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | N-methyl-4-(2,2,2-trifluoroethylamino)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C9H11F3N2O2S/c1-13-17(15,16)8-4-2-7(3-5-8)14-6-9(10,11)12/h2-5,13-14H,6H2,1H3 |
| InChIKey | OCWJYPMGQMBUEO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |