C15H23F2NO3S — CID 111515879
3-[[4-(difluoromethylsulfonyl)anilino]methyl]-3-ethylpentan-1-ol (PubChem CID 111515879) has the molecular formula C15H23F2NO3S and a molecular weight of 335.42 g/mol. Its IUPAC name is 3-[[4-(difluoromethylsulfonyl)anilino]methyl]-3-ethylpentan-1-ol.
| Compound Name | 3-[[4-(difluoromethylsulfonyl)anilino]methyl]-3-ethylpentan-1-ol |
|---|---|
| PubChem CID | 111515879 |
| Molecular Formula | C15H23F2NO3S |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 3-[[4-(difluoromethylsulfonyl)anilino]methyl]-3-ethylpentan-1-ol |
| SMILES | CCC(CC)(CCO)CNc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C15H23F2NO3S/c1-3-15(4-2,9-10-19)11-18-12-5-7-13(8-6-12)22(20,21)14(16)17/h5-8,14,18-19H,3-4,9-11H2,1-2H3 |
| InChIKey | OAHDBYSVTSFKSN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |