C12H10BrF2NO2S2 — CID 43683904
N-[(4-bromothiophen-2-yl)methyl]-4-(difluoromethylsulfonyl)aniline (PubChem CID 43683904) has the molecular formula C12H10BrF2NO2S2 and a molecular weight of 382.25 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-4-(difluoromethylsulfonyl)aniline.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-4-(difluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 43683904 |
| Molecular Formula | C12H10BrF2NO2S2 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 380.93 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-4-(difluoromethylsulfonyl)aniline |
| SMILES | O=S(=O)(c1ccc(NCc2cc(Br)cs2)cc1)C(F)F |
| InChI | InChI=1S/C12H10BrF2NO2S2/c13-8-5-10(19-7-8)6-16-9-1-3-11(4-2-9)20(17,18)12(14)15/h1-5,7,12,16H,6H2 |
| InChIKey | AFLYEEVYKWIJJE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |