C10H9F2N3O2S2 — CID 43683901
4-(difluoromethylsulfonyl)-N-(thiadiazol-4-ylmethyl)aniline (PubChem CID 43683901) has the molecular formula C10H9F2N3O2S2 and a molecular weight of 305.33 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-(thiadiazol-4-ylmethyl)aniline.
| Compound Name | 4-(difluoromethylsulfonyl)-N-(thiadiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 43683901 |
| Molecular Formula | C10H9F2N3O2S2 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-(thiadiazol-4-ylmethyl)aniline |
| SMILES | O=S(=O)(c1ccc(NCc2csnn2)cc1)C(F)F |
| InChI | InChI=1S/C10H9F2N3O2S2/c11-10(12)19(16,17)9-3-1-7(2-4-9)13-5-8-6-18-15-14-8/h1-4,6,10,13H,5H2 |
| InChIKey | RSFVCNKKDJJQIT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |