C11H10F2N2O2S2 — CID 62759433
4-(difluoromethylsulfonyl)-N-(1,3-thiazol-5-ylmethyl)aniline (PubChem CID 62759433) has the molecular formula C11H10F2N2O2S2 and a molecular weight of 304.34 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-(1,3-thiazol-5-ylmethyl)aniline.
| Compound Name | 4-(difluoromethylsulfonyl)-N-(1,3-thiazol-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 62759433 |
| Molecular Formula | C11H10F2N2O2S2 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-(1,3-thiazol-5-ylmethyl)aniline |
| SMILES | O=S(=O)(c1ccc(NCc2cncs2)cc1)C(F)F |
| InChI | InChI=1S/C11H10F2N2O2S2/c12-11(13)19(16,17)10-3-1-8(2-4-10)15-6-9-5-14-7-18-9/h1-5,7,11,15H,6H2 |
| InChIKey | YEXHTVWJVSXPSM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |