About 4-(difluoromethylsulfonyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]aniline
4-(difluoromethylsulfonyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]aniline (PubChem CID 103894474) has the molecular formula C13H14F2N2O3S
and a molecular weight of 316.33 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]aniline.
Molecular Properties
| Compound Name | 4-(difluoromethylsulfonyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]aniline |
| PubChem CID | 103894474 |
| Molecular Formula | C13H14F2N2O3S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]aniline |
| SMILES | Cc1nc(CNc2ccc(S(=O)(=O)C(F)F)cc2)oc1C |
| InChI | InChI=1S/C13H14F2N2O3S/c1-8-9(2)20-12(17-8)7-16-10-3-5-11(6-4-10)21(18,19)13(14)15/h3-6,13,16H,7H2,1-2H3 |
| InChIKey | FABVJYHMTIMNQJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(difluoromethylsulfonyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethylsulfonyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]aniline?
The IUPAC name of 4-(difluoromethylsulfonyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]aniline (CID 103894474) is 4-(difluoromethylsulfonyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]aniline.
What is the SMILES notation for 4-(difluoromethylsulfonyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]aniline?
The canonical SMILES for 4-(difluoromethylsulfonyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]aniline is Cc1nc(CNc2ccc(S(=O)(=O)C(F)F)cc2)oc1C.
What is the InChIKey of 4-(difluoromethylsulfonyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]aniline?
The InChIKey is FABVJYHMTIMNQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2N2O3S/c1-8-9(2)20-12(17-8)7-16-10-3-5-11(6-4-10)21(18,19)13(14)15/h3-6,13,16H,7H2,1-2H3.
What are the key properties of 4-(difluoromethylsulfonyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]aniline?
4-(difluoromethylsulfonyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]aniline has a molecular weight of 316.33 g/mol, XLogP of 2.90, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethylsulfonyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]aniline is sourced from PubChem (CID 103894474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).