C12H12IN3O3 — CID 47357957
N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-iodo-4-nitroaniline (PubChem CID 47357957) has the molecular formula C12H12IN3O3 and a molecular weight of 373.15 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-iodo-4-nitroaniline.
| Compound Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-iodo-4-nitroaniline |
|---|---|
| PubChem CID | 47357957 |
| Molecular Formula | C12H12IN3O3 |
| Molecular Weight | 373.15 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-iodo-4-nitroaniline |
| SMILES | Cc1nc(CNc2ccc([N+](=O)[O-])c(I)c2)oc1C |
| InChI | InChI=1S/C12H12IN3O3/c1-7-8(2)19-12(15-7)6-14-9-3-4-11(16(17)18)10(13)5-9/h3-5,14H,6H2,1-2H3 |
| InChIKey | GXGWUFQTWQTGFS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.15 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|