C11H14N6O3 — CID 106379036
N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-hydrazinyl-3-nitropyridin-2-amine (PubChem CID 106379036) has the molecular formula C11H14N6O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-hydrazinyl-3-nitropyridin-2-amine.
| Compound Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-hydrazinyl-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 106379036 |
| Molecular Formula | C11H14N6O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-hydrazinyl-3-nitropyridin-2-amine |
| SMILES | Cc1nc(CNc2nc(NN)ccc2[N+](=O)[O-])oc1C |
| InChI | InChI=1S/C11H14N6O3/c1-6-7(2)20-10(14-6)5-13-11-8(17(18)19)3-4-9(15-11)16-12/h3-4H,5,12H2,1-2H3,(H2,13,15,16) |
| InChIKey | GPXCJFGDJDOVPU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|