C10H12N6O3 — CID 106378852
4-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 106378852) has the molecular formula C10H12N6O3 and a molecular weight of 264.25 g/mol. Its IUPAC name is 4-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 4-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 106378852 |
| Molecular Formula | C10H12N6O3 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 4-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | Cc1nc(CNc2nc(N)ncc2[N+](=O)[O-])oc1C |
| InChI | InChI=1S/C10H12N6O3/c1-5-6(2)19-8(14-5)4-12-9-7(16(17)18)3-13-10(11)15-9/h3H,4H2,1-2H3,(H3,11,12,13,15) |
| InChIKey | RRAWZRYZEFTBSK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 133.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|