C12H14F2N4O2S — CID 79529335
4-[[4-(difluoromethylsulfonyl)anilino]methyl]-1-methylpyrazol-5-amine (PubChem CID 79529335) has the molecular formula C12H14F2N4O2S and a molecular weight of 316.33 g/mol. Its IUPAC name is 4-[[4-(difluoromethylsulfonyl)anilino]methyl]-1-methylpyrazol-5-amine.
| Compound Name | 4-[[4-(difluoromethylsulfonyl)anilino]methyl]-1-methylpyrazol-5-amine |
|---|---|
| PubChem CID | 79529335 |
| Molecular Formula | C12H14F2N4O2S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 4-[[4-(difluoromethylsulfonyl)anilino]methyl]-1-methylpyrazol-5-amine |
| SMILES | Cn1ncc(CNc2ccc(S(=O)(=O)C(F)F)cc2)c1N |
| InChI | InChI=1S/C12H14F2N4O2S/c1-18-11(15)8(7-17-18)6-16-9-2-4-10(5-3-9)21(19,20)12(13)14/h2-5,7,12,16H,6,15H2,1H3 |
| InChIKey | LKVRQJOZJVMWFG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |