C13H19N5O2S — CID 79529334
4-[(5-amino-1-methylpyrazol-4-yl)methylamino]-N-ethylbenzenesulfonamide (PubChem CID 79529334) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is 4-[(5-amino-1-methylpyrazol-4-yl)methylamino]-N-ethylbenzenesulfonamide.
| Compound Name | 4-[(5-amino-1-methylpyrazol-4-yl)methylamino]-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 79529334 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 4-[(5-amino-1-methylpyrazol-4-yl)methylamino]-N-ethylbenzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(NCc2cnn(C)c2N)cc1 |
| InChI | InChI=1S/C13H19N5O2S/c1-3-17-21(19,20)12-6-4-11(5-7-12)15-8-10-9-16-18(2)13(10)14/h4-7,9,15,17H,3,8,14H2,1-2H3 |
| InChIKey | MSPZGBVYGKNTOP-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |