C10H11N5O2S2 — CID 106272938
N-[(5-amino-1-methylpyrazol-4-yl)methyl]-5-cyanothiophene-2-sulfonamide (PubChem CID 106272938) has the molecular formula C10H11N5O2S2 and a molecular weight of 297.37 g/mol. Its IUPAC name is N-[(5-amino-1-methylpyrazol-4-yl)methyl]-5-cyanothiophene-2-sulfonamide.
| Compound Name | N-[(5-amino-1-methylpyrazol-4-yl)methyl]-5-cyanothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106272938 |
| Molecular Formula | C10H11N5O2S2 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | N-[(5-amino-1-methylpyrazol-4-yl)methyl]-5-cyanothiophene-2-sulfonamide |
| SMILES | Cn1ncc(CNS(=O)(=O)c2ccc(C#N)s2)c1N |
| InChI | InChI=1S/C10H11N5O2S2/c1-15-10(12)7(5-13-15)6-14-19(16,17)9-3-2-8(4-11)18-9/h2-3,5,14H,6,12H2,1H3 |
| InChIKey | LSICMDFKRCMBAW-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |