C11H12N4O2S2 — CID 106268698
5-cyano-N-[2-(1-methylpyrazol-4-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 106268698) has the molecular formula C11H12N4O2S2 and a molecular weight of 296.38 g/mol. Its IUPAC name is 5-cyano-N-[2-(1-methylpyrazol-4-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-[2-(1-methylpyrazol-4-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106268698 |
| Molecular Formula | C11H12N4O2S2 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 5-cyano-N-[2-(1-methylpyrazol-4-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | Cn1cc(CCNS(=O)(=O)c2ccc(C#N)s2)cn1 |
| InChI | InChI=1S/C11H12N4O2S2/c1-15-8-9(7-13-15)4-5-14-19(16,17)11-3-2-10(6-12)18-11/h2-3,7-8,14H,4-5H2,1H3 |
| InChIKey | SHSUSRHTMBBRMN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |