C9H12N2O4S3 — CID 114166224
5-cyano-N-(3-methylsulfonylpropyl)thiophene-2-sulfonamide (PubChem CID 114166224) has the molecular formula C9H12N2O4S3 and a molecular weight of 308.41 g/mol. Its IUPAC name is 5-cyano-N-(3-methylsulfonylpropyl)thiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-(3-methylsulfonylpropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 114166224 |
| Molecular Formula | C9H12N2O4S3 |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 5-cyano-N-(3-methylsulfonylpropyl)thiophene-2-sulfonamide |
| SMILES | CS(=O)(=O)CCCNS(=O)(=O)c1ccc(C#N)s1 |
| InChI | InChI=1S/C9H12N2O4S3/c1-17(12,13)6-2-5-11-18(14,15)9-4-3-8(7-10)16-9/h3-4,11H,2,5-6H2,1H3 |
| InChIKey | PGSWJTUEPXQACS-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|