C13H18N2O4S2 — CID 106265633
6-[(5-cyanothiophen-2-yl)sulfonylamino]-4-ethylhexanoic acid (PubChem CID 106265633) has the molecular formula C13H18N2O4S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 6-[(5-cyanothiophen-2-yl)sulfonylamino]-4-ethylhexanoic acid.
| Compound Name | 6-[(5-cyanothiophen-2-yl)sulfonylamino]-4-ethylhexanoic acid |
|---|---|
| PubChem CID | 106265633 |
| Molecular Formula | C13H18N2O4S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 6-[(5-cyanothiophen-2-yl)sulfonylamino]-4-ethylhexanoic acid |
| SMILES | CCC(CCNS(=O)(=O)c1ccc(C#N)s1)CCC(=O)O |
| InChI | InChI=1S/C13H18N2O4S2/c1-2-10(3-5-12(16)17)7-8-15-21(18,19)13-6-4-11(9-14)20-13/h4,6,10,15H,2-3,5,7-8H2,1H3,(H,16,17) |
| InChIKey | ZGAKTYLEOSFECJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |