C9H9N3O2S2 — CID 106266730
5-cyano-N-(1-cyanopropyl)thiophene-2-sulfonamide (PubChem CID 106266730) has the molecular formula C9H9N3O2S2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 5-cyano-N-(1-cyanopropyl)thiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-(1-cyanopropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106266730 |
| Molecular Formula | C9H9N3O2S2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | 5-cyano-N-(1-cyanopropyl)thiophene-2-sulfonamide |
| SMILES | CCC(C#N)NS(=O)(=O)c1ccc(C#N)s1 |
| InChI | InChI=1S/C9H9N3O2S2/c1-2-7(5-10)12-16(13,14)9-4-3-8(6-11)15-9/h3-4,7,12H,2H2,1H3 |
| InChIKey | YCGTZOHTRHNGAA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |