C11H16N2O3S2 — CID 114166270
5-cyano-N-(1-methoxypentan-2-yl)thiophene-2-sulfonamide (PubChem CID 114166270) has the molecular formula C11H16N2O3S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 5-cyano-N-(1-methoxypentan-2-yl)thiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-(1-methoxypentan-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 114166270 |
| Molecular Formula | C11H16N2O3S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 5-cyano-N-(1-methoxypentan-2-yl)thiophene-2-sulfonamide |
| SMILES | CCCC(COC)NS(=O)(=O)c1ccc(C#N)s1 |
| InChI | InChI=1S/C11H16N2O3S2/c1-3-4-9(8-16-2)13-18(14,15)11-6-5-10(7-12)17-11/h5-6,9,13H,3-4,8H2,1-2H3 |
| InChIKey | BAEAWOKSZOUOSD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |