C11H12N2O2S2 — CID 106269838
5-cyano-N-hex-1-yn-3-ylthiophene-2-sulfonamide (PubChem CID 106269838) has the molecular formula C11H12N2O2S2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 5-cyano-N-hex-1-yn-3-ylthiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-hex-1-yn-3-ylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106269838 |
| Molecular Formula | C11H12N2O2S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 5-cyano-N-hex-1-yn-3-ylthiophene-2-sulfonamide |
| SMILES | C#CC(CCC)NS(=O)(=O)c1ccc(C#N)s1 |
| InChI | InChI=1S/C11H12N2O2S2/c1-3-5-9(4-2)13-17(14,15)11-7-6-10(8-12)16-11/h2,6-7,9,13H,3,5H2,1H3 |
| InChIKey | AZXUHKLXFONPNG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|