C11H15NO2S2 — CID 106898897
N-hex-1-yn-3-yl-5-methylthiophene-2-sulfonamide (PubChem CID 106898897) has the molecular formula C11H15NO2S2 and a molecular weight of 257.38 g/mol. Its IUPAC name is N-hex-1-yn-3-yl-5-methylthiophene-2-sulfonamide.
| Compound Name | N-hex-1-yn-3-yl-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106898897 |
| Molecular Formula | C11H15NO2S2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | N-hex-1-yn-3-yl-5-methylthiophene-2-sulfonamide |
| SMILES | C#CC(CCC)NS(=O)(=O)c1ccc(C)s1 |
| InChI | InChI=1S/C11H15NO2S2/c1-4-6-10(5-2)12-16(13,14)11-8-7-9(3)15-11/h2,7-8,10,12H,4,6H2,1,3H3 |
| InChIKey | UEMAGDGCCMPKAO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|