C10H8N2O4S2 — CID 106265822
2-[(5-cyanothiophen-2-yl)sulfonylamino]pent-4-ynoic acid (PubChem CID 106265822) has the molecular formula C10H8N2O4S2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 2-[(5-cyanothiophen-2-yl)sulfonylamino]pent-4-ynoic acid.
| Compound Name | 2-[(5-cyanothiophen-2-yl)sulfonylamino]pent-4-ynoic acid |
|---|---|
| PubChem CID | 106265822 |
| Molecular Formula | C10H8N2O4S2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | 2-[(5-cyanothiophen-2-yl)sulfonylamino]pent-4-ynoic acid |
| SMILES | C#CCC(NS(=O)(=O)c1ccc(C#N)s1)C(=O)O |
| InChI | InChI=1S/C10H8N2O4S2/c1-2-3-8(10(13)14)12-18(15,16)9-5-4-7(6-11)17-9/h1,4-5,8,12H,3H2,(H,13,14) |
| InChIKey | IJNLIXCHBYTPJR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|