C10H13N3O3S2 — CID 106345606
2-[(5-cyanothiophen-2-yl)sulfonylamino]-3-methylbutanamide (PubChem CID 106345606) has the molecular formula C10H13N3O3S2 and a molecular weight of 287.37 g/mol. Its IUPAC name is 2-[(5-cyanothiophen-2-yl)sulfonylamino]-3-methylbutanamide.
| Compound Name | 2-[(5-cyanothiophen-2-yl)sulfonylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106345606 |
| Molecular Formula | C10H13N3O3S2 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 2-[(5-cyanothiophen-2-yl)sulfonylamino]-3-methylbutanamide |
| SMILES | CC(C)C(NS(=O)(=O)c1ccc(C#N)s1)C(N)=O |
| InChI | InChI=1S/C10H13N3O3S2/c1-6(2)9(10(12)14)13-18(15,16)8-4-3-7(5-11)17-8/h3-4,6,9,13H,1-2H3,(H2,12,14) |
| InChIKey | CLPHYBNVIOHPRH-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |