C10H12N2O4S3 — CID 114165907
(2S)-2-[(5-cyanothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoic acid (PubChem CID 114165907) has the molecular formula C10H12N2O4S3 and a molecular weight of 320.42 g/mol. Its IUPAC name is (2S)-2-[(5-cyanothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[(5-cyanothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 114165907 |
| Molecular Formula | C10H12N2O4S3 |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | (2S)-2-[(5-cyanothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NS(=O)(=O)c1ccc(C#N)s1)C(=O)O |
| InChI | InChI=1S/C10H12N2O4S3/c1-17-5-4-8(10(13)14)12-19(15,16)9-3-2-7(6-11)18-9/h2-3,8,12H,4-5H2,1H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | WKSBMADXZRQIJB-QMMMGPOBSA-N |
| XLogP | 1.10 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |