C9H12ClNO4S3 — CID 61144815
(2S)-2-[(5-chlorothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoic acid (PubChem CID 61144815) has the molecular formula C9H12ClNO4S3 and a molecular weight of 329.85 g/mol. Its IUPAC name is (2S)-2-[(5-chlorothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[(5-chlorothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 61144815 |
| Molecular Formula | C9H12ClNO4S3 |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 328.96 |
| IUPAC Name | (2S)-2-[(5-chlorothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NS(=O)(=O)c1ccc(Cl)s1)C(=O)O |
| InChI | InChI=1S/C9H12ClNO4S3/c1-16-5-4-6(9(12)13)11-18(14,15)8-3-2-7(10)17-8/h2-3,6,11H,4-5H2,1H3,(H,12,13)/t6-/m0/s1 |
| InChIKey | RVEQTUFDBIUDFP-LURJTMIESA-N |
| XLogP | 1.89 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |