C7H8ClNO5S2 — CID 80751001
(2R)-2-[(5-chlorothiophen-2-yl)sulfonylamino]-3-hydroxypropanoic acid (PubChem CID 80751001) has the molecular formula C7H8ClNO5S2 and a molecular weight of 285.73 g/mol. Its IUPAC name is (2R)-2-[(5-chlorothiophen-2-yl)sulfonylamino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[(5-chlorothiophen-2-yl)sulfonylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 80751001 |
| Molecular Formula | C7H8ClNO5S2 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 284.95 |
| IUPAC Name | (2R)-2-[(5-chlorothiophen-2-yl)sulfonylamino]-3-hydroxypropanoic acid |
| SMILES | O=C(O)[C@@H](CO)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C7H8ClNO5S2/c8-5-1-2-6(15-5)16(13,14)9-4(3-10)7(11)12/h1-2,4,9-10H,3H2,(H,11,12)/t4-/m1/s1 |
| InChIKey | CSCMXQDXVFIWOB-SCSAIBSYSA-N |
| XLogP | 0.13 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |