C16H20ClNO3S2 — CID 66930190
5-chloro-N-[(2S,3S)-1-hydroxy-3-phenylhexan-2-yl]thiophene-2-sulfonamide (PubChem CID 66930190) has the molecular formula C16H20ClNO3S2 and a molecular weight of 373.93 g/mol. Its IUPAC name is 5-chloro-N-[(2S,3S)-1-hydroxy-3-phenylhexan-2-yl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[(2S,3S)-1-hydroxy-3-phenylhexan-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 66930190 |
| Molecular Formula | C16H20ClNO3S2 |
| Molecular Weight | 373.93 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 5-chloro-N-[(2S,3S)-1-hydroxy-3-phenylhexan-2-yl]thiophene-2-sulfonamide |
| SMILES | CCC[C@@H](c1ccccc1)[C@@H](CO)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H20ClNO3S2/c1-2-6-13(12-7-4-3-5-8-12)14(11-19)18-23(20,21)16-10-9-15(17)22-16/h3-5,7-10,13-14,18-19H,2,6,11H2,1H3/t13-,14+/m0/s1 |
| InChIKey | CAMLIKVIEVGUST-UONOGXRCSA-N |
| XLogP | 3.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.93 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |