C16H28ClNO3S2 — CID 22500763
5-chloro-N-(1-hydroxy-3-propylnonan-2-yl)thiophene-2-sulfonamide (PubChem CID 22500763) has the molecular formula C16H28ClNO3S2 and a molecular weight of 381.99 g/mol. Its IUPAC name is 5-chloro-N-(1-hydroxy-3-propylnonan-2-yl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(1-hydroxy-3-propylnonan-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22500763 |
| Molecular Formula | C16H28ClNO3S2 |
| Molecular Weight | 381.99 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 5-chloro-N-(1-hydroxy-3-propylnonan-2-yl)thiophene-2-sulfonamide |
| SMILES | CCCCCCC(CCC)C(CO)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H28ClNO3S2/c1-3-5-6-7-9-13(8-4-2)14(12-19)18-23(20,21)16-11-10-15(17)22-16/h10-11,13-14,18-19H,3-9,12H2,1-2H3 |
| InChIKey | SLBCXBXZOZRPGE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.99 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|