C18H30BrNO3S — CID 10387409
4-bromo-N-[(2S,3R)-1-hydroxy-3-propylnonan-2-yl]benzenesulfonamide (PubChem CID 10387409) has the molecular formula C18H30BrNO3S and a molecular weight of 420.41 g/mol. Its IUPAC name is 4-bromo-N-[(2S,3R)-1-hydroxy-3-propylnonan-2-yl]benzenesulfonamide.
| Compound Name | 4-bromo-N-[(2S,3R)-1-hydroxy-3-propylnonan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10387409 |
| Molecular Formula | C18H30BrNO3S |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 4-bromo-N-[(2S,3R)-1-hydroxy-3-propylnonan-2-yl]benzenesulfonamide |
| SMILES | CCCCCC[C@@H](CCC)[C@@H](CO)NS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H30BrNO3S/c1-3-5-6-7-9-15(8-4-2)18(14-21)20-24(22,23)17-12-10-16(19)11-13-17/h10-13,15,18,20-21H,3-9,14H2,1-2H3/t15-,18-/m1/s1 |
| InChIKey | YLBAJIWZTPZLSY-CRAIPNDOSA-N |
| XLogP | 4.47 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|