C24H32BrNO4S — CID 23353836
methyl 4-[4-[1-[(4-bromophenyl)sulfonylamino]heptyl]phenyl]butanoate (PubChem CID 23353836) has the molecular formula C24H32BrNO4S and a molecular weight of 510.49 g/mol. Its IUPAC name is methyl 4-[4-[1-[(4-bromophenyl)sulfonylamino]heptyl]phenyl]butanoate.
| Compound Name | methyl 4-[4-[1-[(4-bromophenyl)sulfonylamino]heptyl]phenyl]butanoate |
|---|---|
| PubChem CID | 23353836 |
| Molecular Formula | C24H32BrNO4S |
| Molecular Weight | 510.49 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | methyl 4-[4-[1-[(4-bromophenyl)sulfonylamino]heptyl]phenyl]butanoate |
| SMILES | CCCCCCC(NS(=O)(=O)c1ccc(Br)cc1)c1ccc(CCCC(=O)OC)cc1 |
| InChI | InChI=1S/C24H32BrNO4S/c1-3-4-5-6-9-23(26-31(28,29)22-17-15-21(25)16-18-22)20-13-11-19(12-14-20)8-7-10-24(27)30-2/h11-18,23,26H,3-10H2,1-2H3 |
| InChIKey | YOBNYFNQZFQTHF-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.49 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|