C21H27NO4S — CID 139616765
methyl 7-[(4-methylphenyl)sulfonylamino]-7-phenylheptanoate (PubChem CID 139616765) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is methyl 7-[(4-methylphenyl)sulfonylamino]-7-phenylheptanoate.
| Compound Name | methyl 7-[(4-methylphenyl)sulfonylamino]-7-phenylheptanoate |
|---|---|
| PubChem CID | 139616765 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | methyl 7-[(4-methylphenyl)sulfonylamino]-7-phenylheptanoate |
| SMILES | COC(=O)CCCCCC(NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO4S/c1-17-13-15-19(16-14-17)27(24,25)22-20(18-9-5-3-6-10-18)11-7-4-8-12-21(23)26-2/h3,5-6,9-10,13-16,20,22H,4,7-8,11-12H2,1-2H3 |
| InChIKey | COQNVEMXWKJSLH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|