C20H24FNO4S — CID 139616882
7-(4-fluorophenyl)-7-[(4-methylphenyl)sulfonylamino]heptanoic acid (PubChem CID 139616882) has the molecular formula C20H24FNO4S and a molecular weight of 393.48 g/mol. Its IUPAC name is 7-(4-fluorophenyl)-7-[(4-methylphenyl)sulfonylamino]heptanoic acid.
| Compound Name | 7-(4-fluorophenyl)-7-[(4-methylphenyl)sulfonylamino]heptanoic acid |
|---|---|
| PubChem CID | 139616882 |
| Molecular Formula | C20H24FNO4S |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 7-(4-fluorophenyl)-7-[(4-methylphenyl)sulfonylamino]heptanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)NC(CCCCCC(=O)O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H24FNO4S/c1-15-7-13-18(14-8-15)27(25,26)22-19(5-3-2-4-6-20(23)24)16-9-11-17(21)12-10-16/h7-14,19,22H,2-6H2,1H3,(H,23,24) |
| InChIKey | OMDFMFGOJABMTJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|