C20H21F4NO4S — CID 139616889
7-(4-fluorophenyl)-7-[[2-(trifluoromethyl)phenyl]sulfonylamino]heptanoic acid (PubChem CID 139616889) has the molecular formula C20H21F4NO4S and a molecular weight of 447.45 g/mol. Its IUPAC name is 7-(4-fluorophenyl)-7-[[2-(trifluoromethyl)phenyl]sulfonylamino]heptanoic acid.
| Compound Name | 7-(4-fluorophenyl)-7-[[2-(trifluoromethyl)phenyl]sulfonylamino]heptanoic acid |
|---|---|
| PubChem CID | 139616889 |
| Molecular Formula | C20H21F4NO4S |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 7-(4-fluorophenyl)-7-[[2-(trifluoromethyl)phenyl]sulfonylamino]heptanoic acid |
| SMILES | O=C(O)CCCCCC(NS(=O)(=O)c1ccccc1C(F)(F)F)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H21F4NO4S/c21-15-12-10-14(11-13-15)17(7-2-1-3-9-19(26)27)25-30(28,29)18-8-5-4-6-16(18)20(22,23)24/h4-6,8,10-13,17,25H,1-3,7,9H2,(H,26,27) |
| InChIKey | BZRQAKUGELXOTC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|