C20H16F3NO2S — CID 2568637
N-benzhydryl-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 2568637) has the molecular formula C20H16F3NO2S and a molecular weight of 391.41 g/mol. Its IUPAC name is N-benzhydryl-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-benzhydryl-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2568637 |
| Molecular Formula | C20H16F3NO2S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | N-benzhydryl-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NC(c1ccccc1)c1ccccc1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H16F3NO2S/c21-20(22,23)17-13-7-8-14-18(17)27(25,26)24-19(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,19,24H |
| InChIKey | MRXICSPKKWJCSR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |