C24H16F6N2O4S2 — CID 172801513
2-(trifluoromethyl)-N-[4-[[2-(trifluoromethyl)phenyl]sulfonylamino]naphthalen-1-yl]benzenesulfonamide (PubChem CID 172801513) has the molecular formula C24H16F6N2O4S2 and a molecular weight of 574.52 g/mol. Its IUPAC name is 2-(trifluoromethyl)-N-[4-[[2-(trifluoromethyl)phenyl]sulfonylamino]naphthalen-1-yl]benzenesulfonamide.
| Compound Name | 2-(trifluoromethyl)-N-[4-[[2-(trifluoromethyl)phenyl]sulfonylamino]naphthalen-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 172801513 |
| Molecular Formula | C24H16F6N2O4S2 |
| Molecular Weight | 574.52 g/mol |
| Exact Mass | 574.05 |
| IUPAC Name | 2-(trifluoromethyl)-N-[4-[[2-(trifluoromethyl)phenyl]sulfonylamino]naphthalen-1-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(NS(=O)(=O)c2ccccc2C(F)(F)F)c2ccccc12)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C24H16F6N2O4S2/c25-23(26,27)17-9-3-5-11-21(17)37(33,34)31-19-13-14-20(16-8-2-1-7-15(16)19)32-38(35,36)22-12-6-4-10-18(22)24(28,29)30/h1-14,31-32H |
| InChIKey | QXVLLFBXRXDIBH-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.52 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'} |
|---|