C9H10F3NO2S — CID 43212836
N-ethyl-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 43212836) has the molecular formula C9H10F3NO2S and a molecular weight of 253.25 g/mol. Its IUPAC name is N-ethyl-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-ethyl-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43212836 |
| Molecular Formula | C9H10F3NO2S |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | N-ethyl-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C9H10F3NO2S/c1-2-13-16(14,15)8-6-4-3-5-7(8)9(10,11)12/h3-6,13H,2H2,1H3 |
| InChIKey | MIYZJAGXTUTXPR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |