C11H14F3NO3S — CID 64911010
N-(3-hydroxybutyl)-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 64911010) has the molecular formula C11H14F3NO3S and a molecular weight of 297.30 g/mol. Its IUPAC name is N-(3-hydroxybutyl)-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(3-hydroxybutyl)-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 64911010 |
| Molecular Formula | C11H14F3NO3S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | N-(3-hydroxybutyl)-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(O)CCNS(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H14F3NO3S/c1-8(16)6-7-15-19(17,18)10-5-3-2-4-9(10)11(12,13)14/h2-5,8,15-16H,6-7H2,1H3 |
| InChIKey | JPPQXCMKCZKBFN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |