C11H13F3O4S — CID 86761982
3-hydroxybutyl 2-(trifluoromethyl)benzenesulfonate (PubChem CID 86761982) has the molecular formula C11H13F3O4S and a molecular weight of 298.28 g/mol. Its IUPAC name is 3-hydroxybutyl 2-(trifluoromethyl)benzenesulfonate.
| Compound Name | 3-hydroxybutyl 2-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 86761982 |
| Molecular Formula | C11H13F3O4S |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 3-hydroxybutyl 2-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(O)CCOS(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H13F3O4S/c1-8(15)6-7-18-19(16,17)10-5-3-2-4-9(10)11(12,13)14/h2-5,8,15H,6-7H2,1H3 |
| InChIKey | AHLVMWDLOCCBRM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|