C14H21F3N2O2S — CID 119992166
N-(3-amino-4-methylpentyl)-N-methyl-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 119992166) has the molecular formula C14H21F3N2O2S and a molecular weight of 338.40 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-N-methyl-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(3-amino-4-methylpentyl)-N-methyl-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 119992166 |
| Molecular Formula | C14H21F3N2O2S |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-N-methyl-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(C)C(N)CCN(C)S(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H21F3N2O2S/c1-10(2)12(18)8-9-19(3)22(20,21)13-7-5-4-6-11(13)14(15,16)17/h4-7,10,12H,8-9,18H2,1-3H3 |
| InChIKey | GUXYUYJKCOERFH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |