C19H34ClN3O3S — CID 119992074
2-[(3-amino-4-methylpentyl)-methylsulfamoyl]-N-butyl-N-methylbenzamide;hydrochloride (PubChem CID 119992074) has the molecular formula C19H34ClN3O3S and a molecular weight of 420.02 g/mol. Its IUPAC name is 2-[(3-amino-4-methylpentyl)-methylsulfamoyl]-N-butyl-N-methylbenzamide;hydrochloride.
| Compound Name | 2-[(3-amino-4-methylpentyl)-methylsulfamoyl]-N-butyl-N-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119992074 |
| Molecular Formula | C19H34ClN3O3S |
| Molecular Weight | 420.02 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 2-[(3-amino-4-methylpentyl)-methylsulfamoyl]-N-butyl-N-methylbenzamide;hydrochloride |
| SMILES | CCCCN(C)C(=O)c1ccccc1S(=O)(=O)N(C)CCC(N)C(C)C.Cl |
| InChI | InChI=1S/C19H33N3O3S.ClH/c1-6-7-13-21(4)19(23)16-10-8-9-11-18(16)26(24,25)22(5)14-12-17(20)15(2)3;/h8-11,15,17H,6-7,12-14,20H2,1-5H3;1H |
| InChIKey | FKKSCUFIQCXZJV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.02 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |