C18H30ClN3O3S — CID 119965750
N-butyl-N-methyl-2-[methyl(piperidin-4-yl)sulfamoyl]benzamide;hydrochloride (PubChem CID 119965750) has the molecular formula C18H30ClN3O3S and a molecular weight of 403.98 g/mol. Its IUPAC name is N-butyl-N-methyl-2-[methyl(piperidin-4-yl)sulfamoyl]benzamide;hydrochloride.
| Compound Name | N-butyl-N-methyl-2-[methyl(piperidin-4-yl)sulfamoyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119965750 |
| Molecular Formula | C18H30ClN3O3S |
| Molecular Weight | 403.98 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-butyl-N-methyl-2-[methyl(piperidin-4-yl)sulfamoyl]benzamide;hydrochloride |
| SMILES | CCCCN(C)C(=O)c1ccccc1S(=O)(=O)N(C)C1CCNCC1.Cl |
| InChI | InChI=1S/C18H29N3O3S.ClH/c1-4-5-14-20(2)18(22)16-8-6-7-9-17(16)25(23,24)21(3)15-10-12-19-13-11-15;/h6-9,15,19H,4-5,10-14H2,1-3H3;1H |
| InChIKey | JUQQKXYLBNCIMX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.98 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |