C18H29N3O3S — CID 120725952
N-butyl-2-(2,3-dimethylpiperazin-1-yl)sulfonyl-N-methylbenzamide (PubChem CID 120725952) has the molecular formula C18H29N3O3S and a molecular weight of 367.52 g/mol. Its IUPAC name is N-butyl-2-(2,3-dimethylpiperazin-1-yl)sulfonyl-N-methylbenzamide.
| Compound Name | N-butyl-2-(2,3-dimethylpiperazin-1-yl)sulfonyl-N-methylbenzamide |
|---|---|
| PubChem CID | 120725952 |
| Molecular Formula | C18H29N3O3S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | N-butyl-2-(2,3-dimethylpiperazin-1-yl)sulfonyl-N-methylbenzamide |
| SMILES | CCCCN(C)C(=O)c1ccccc1S(=O)(=O)N1CCNC(C)C1C |
| InChI | InChI=1S/C18H29N3O3S/c1-5-6-12-20(4)18(22)16-9-7-8-10-17(16)25(23,24)21-13-11-19-14(2)15(21)3/h7-10,14-15,19H,5-6,11-13H2,1-4H3 |
| InChIKey | UNMTVVCNTSJGAB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |