C15H23NO4S — CID 107202478
2-ethylsulfonyl-N-(5-hydroxypentyl)-N-methylbenzamide (PubChem CID 107202478) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is 2-ethylsulfonyl-N-(5-hydroxypentyl)-N-methylbenzamide.
| Compound Name | 2-ethylsulfonyl-N-(5-hydroxypentyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 107202478 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-ethylsulfonyl-N-(5-hydroxypentyl)-N-methylbenzamide |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)N(C)CCCCCO |
| InChI | InChI=1S/C15H23NO4S/c1-3-21(19,20)14-10-6-5-9-13(14)15(18)16(2)11-7-4-8-12-17/h5-6,9-10,17H,3-4,7-8,11-12H2,1-2H3 |
| InChIKey | HYCGHXHHUIMNGW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|