C14H20BrNO2 — CID 107199925
3-bromo-N-(5-hydroxypentyl)-N,2-dimethylbenzamide (PubChem CID 107199925) has the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. Its IUPAC name is 3-bromo-N-(5-hydroxypentyl)-N,2-dimethylbenzamide.
| Compound Name | 3-bromo-N-(5-hydroxypentyl)-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 107199925 |
| Molecular Formula | C14H20BrNO2 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 3-bromo-N-(5-hydroxypentyl)-N,2-dimethylbenzamide |
| SMILES | Cc1c(Br)cccc1C(=O)N(C)CCCCCO |
| InChI | InChI=1S/C14H20BrNO2/c1-11-12(7-6-8-13(11)15)14(18)16(2)9-4-3-5-10-17/h6-8,17H,3-5,9-10H2,1-2H3 |
| InChIKey | RSNYEPNHHSGNBX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|