C14H22N2O2 — CID 107197361
2-amino-N-(5-hydroxypentyl)-N,5-dimethylbenzamide (PubChem CID 107197361) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-amino-N-(5-hydroxypentyl)-N,5-dimethylbenzamide.
| Compound Name | 2-amino-N-(5-hydroxypentyl)-N,5-dimethylbenzamide |
|---|---|
| PubChem CID | 107197361 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-amino-N-(5-hydroxypentyl)-N,5-dimethylbenzamide |
| SMILES | Cc1ccc(N)c(C(=O)N(C)CCCCCO)c1 |
| InChI | InChI=1S/C14H22N2O2/c1-11-6-7-13(15)12(10-11)14(18)16(2)8-4-3-5-9-17/h6-7,10,17H,3-5,8-9,15H2,1-2H3 |
| InChIKey | BBDUEVYVQCDTDO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|