C14H21FN2O2 — CID 107197446
5-amino-2-fluoro-N-(5-hydroxypentyl)-N,3-dimethylbenzamide (PubChem CID 107197446) has the molecular formula C14H21FN2O2 and a molecular weight of 268.33 g/mol. Its IUPAC name is 5-amino-2-fluoro-N-(5-hydroxypentyl)-N,3-dimethylbenzamide.
| Compound Name | 5-amino-2-fluoro-N-(5-hydroxypentyl)-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 107197446 |
| Molecular Formula | C14H21FN2O2 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 5-amino-2-fluoro-N-(5-hydroxypentyl)-N,3-dimethylbenzamide |
| SMILES | Cc1cc(N)cc(C(=O)N(C)CCCCCO)c1F |
| InChI | InChI=1S/C14H21FN2O2/c1-10-8-11(16)9-12(13(10)15)14(19)17(2)6-4-3-5-7-18/h8-9,18H,3-7,16H2,1-2H3 |
| InChIKey | YRSLFOYKKZYYAO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|