About 6-hydroxyhexyl 5-amino-2-fluoro-3-methylbenzoate
6-hydroxyhexyl 5-amino-2-fluoro-3-methylbenzoate (PubChem CID 107706269) has the molecular formula C14H20FNO3
and a molecular weight of 269.32 g/mol. Its IUPAC name is 6-hydroxyhexyl 5-amino-2-fluoro-3-methylbenzoate.
Molecular Properties
| Compound Name | 6-hydroxyhexyl 5-amino-2-fluoro-3-methylbenzoate |
| PubChem CID | 107706269 |
| Molecular Formula | C14H20FNO3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 6-hydroxyhexyl 5-amino-2-fluoro-3-methylbenzoate |
| SMILES | Cc1cc(N)cc(C(=O)OCCCCCCO)c1F |
| InChI | InChI=1S/C14H20FNO3/c1-10-8-11(16)9-12(13(10)15)14(18)19-7-5-3-2-4-6-17/h8-9,17H,2-7,16H2,1H3 |
| InChIKey | PUGBNJVOLUWDFI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxyhexyl 5-amino-2-fluoro-3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxyhexyl 5-amino-2-fluoro-3-methylbenzoate?
The IUPAC name of 6-hydroxyhexyl 5-amino-2-fluoro-3-methylbenzoate (CID 107706269) is 6-hydroxyhexyl 5-amino-2-fluoro-3-methylbenzoate.
What is the SMILES notation for 6-hydroxyhexyl 5-amino-2-fluoro-3-methylbenzoate?
The canonical SMILES for 6-hydroxyhexyl 5-amino-2-fluoro-3-methylbenzoate is Cc1cc(N)cc(C(=O)OCCCCCCO)c1F.
What is the InChIKey of 6-hydroxyhexyl 5-amino-2-fluoro-3-methylbenzoate?
The InChIKey is PUGBNJVOLUWDFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20FNO3/c1-10-8-11(16)9-12(13(10)15)14(18)19-7-5-3-2-4-6-17/h8-9,17H,2-7,16H2,1H3.
What are the key properties of 6-hydroxyhexyl 5-amino-2-fluoro-3-methylbenzoate?
6-hydroxyhexyl 5-amino-2-fluoro-3-methylbenzoate has a molecular weight of 269.32 g/mol, XLogP of 2.43, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxyhexyl 5-amino-2-fluoro-3-methylbenzoate is sourced from PubChem (CID 107706269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).